C19H17Cl2N3O2S — CID 170922659
[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-[1-(3,4-dimethoxyphenyl)ethyl]diazene (PubChem CID 170922659) has the molecular formula C19H17Cl2N3O2S and a molecular weight of 422.34 g/mol. Its IUPAC name is [4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-[1-(3,4-dimethoxyphenyl)ethyl]diazene.
| Compound Name | [4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-[1-(3,4-dimethoxyphenyl)ethyl]diazene |
|---|---|
| PubChem CID | 170922659 |
| Molecular Formula | C19H17Cl2N3O2S |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | [4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-[1-(3,4-dimethoxyphenyl)ethyl]diazene |
| SMILES | COc1ccc(C(C)/N=N/c2nc(-c3ccc(Cl)cc3Cl)cs2)cc1OC |
| InChI | InChI=1S/C19H17Cl2N3O2S/c1-11(12-4-7-17(25-2)18(8-12)26-3)23-24-19-22-16(10-27-19)14-6-5-13(20)9-15(14)21/h4-11H,1-3H3/b24-23+ |
| InChIKey | RJKNRBSGXDYVSG-WCWDXBQESA-N |
| XLogP | 6.98 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|