About N-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]methyl]propan-2-amine
N-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]methyl]propan-2-amine (PubChem CID 55130036) has the molecular formula C13H14Cl2N2S
and a molecular weight of 301.24 g/mol. Its IUPAC name is N-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]methyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]methyl]propan-2-amine |
| PubChem CID | 55130036 |
| Molecular Formula | C13H14Cl2N2S |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | N-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C13H14Cl2N2S/c1-8(2)16-6-13-17-12(7-18-13)10-4-3-9(14)5-11(10)15/h3-5,7-8,16H,6H2,1-2H3 |
| InChIKey | ADMUKNLKEQGJKZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]methyl]propan-2-amine?
The IUPAC name of N-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]methyl]propan-2-amine (CID 55130036) is N-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]methyl]propan-2-amine.
What is the SMILES notation for N-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]methyl]propan-2-amine?
The canonical SMILES for N-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]methyl]propan-2-amine is CC(C)NCc1nc(-c2ccc(Cl)cc2Cl)cs1.
What is the InChIKey of N-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]methyl]propan-2-amine?
The InChIKey is ADMUKNLKEQGJKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2N2S/c1-8(2)16-6-13-17-12(7-18-13)10-4-3-9(14)5-11(10)15/h3-5,7-8,16H,6H2,1-2H3.
What are the key properties of N-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]methyl]propan-2-amine?
N-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]methyl]propan-2-amine has a molecular weight of 301.24 g/mol, XLogP of 4.61, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]methyl]propan-2-amine is sourced from PubChem (CID 55130036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).