C20H13Cl2NO2 — CID 21373665
[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]-(furan-2-yl)methanone (PubChem CID 21373665) has the molecular formula C20H13Cl2NO2 and a molecular weight of 370.24 g/mol. Its IUPAC name is [1-[(2,4-dichlorophenyl)methyl]indol-3-yl]-(furan-2-yl)methanone.
| Compound Name | [1-[(2,4-dichlorophenyl)methyl]indol-3-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 21373665 |
| Molecular Formula | C20H13Cl2NO2 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | [1-[(2,4-dichlorophenyl)methyl]indol-3-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)c1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C20H13Cl2NO2/c21-14-8-7-13(17(22)10-14)11-23-12-16(15-4-1-2-5-18(15)23)20(24)19-6-3-9-25-19/h1-10,12H,11H2 |
| InChIKey | DIOUHACKBFZYJF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |