C26H26N4OS — CID 3946085
1-(4-methylphenyl)-3-[[1-(3-phenoxypropyl)indol-3-yl]methylideneamino]thiourea (PubChem CID 3946085) has the molecular formula C26H26N4OS and a molecular weight of 442.59 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[[1-(3-phenoxypropyl)indol-3-yl]methylideneamino]thiourea.
| Compound Name | 1-(4-methylphenyl)-3-[[1-(3-phenoxypropyl)indol-3-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 3946085 |
| Molecular Formula | C26H26N4OS |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 1-(4-methylphenyl)-3-[[1-(3-phenoxypropyl)indol-3-yl]methylideneamino]thiourea |
| SMILES | Cc1ccc(NC(=S)NN=Cc2cn(CCCOc3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C26H26N4OS/c1-20-12-14-22(15-13-20)28-26(32)29-27-18-21-19-30(25-11-6-5-10-24(21)25)16-7-17-31-23-8-3-2-4-9-23/h2-6,8-15,18-19H,7,16-17H2,1H3,(H2,28,29,32) |
| InChIKey | PGQYILAPUPAZOQ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 50.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_I(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|