C20H16Br2N2O6 — CID 126017287
(2S)-2-[4-[(Z)-[(5,7-dibromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenoxy]propanoic acid (PubChem CID 126017287) has the molecular formula C20H16Br2N2O6 and a molecular weight of 540.16 g/mol. Its IUPAC name is (2S)-2-[4-[(Z)-[(5,7-dibromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenoxy]propanoic acid.
| Compound Name | (2S)-2-[4-[(Z)-[(5,7-dibromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126017287 |
| Molecular Formula | C20H16Br2N2O6 |
| Molecular Weight | 540.16 g/mol |
| Exact Mass | 537.94 |
| IUPAC Name | (2S)-2-[4-[(Z)-[(5,7-dibromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenoxy]propanoic acid |
| SMILES | COc1cc(/C=N\NC(=O)c2cc3cc(Br)cc(Br)c3o2)ccc1O[C@@H](C)C(=O)O |
| InChI | InChI=1S/C20H16Br2N2O6/c1-10(20(26)27)29-15-4-3-11(5-16(15)28-2)9-23-24-19(25)17-7-12-6-13(21)8-14(22)18(12)30-17/h3-10H,1-2H3,(H,24,25)(H,26,27)/b23-9-/t10-/m0/s1 |
| InChIKey | DCHHLCQCJJDRJQ-JIVRBGOCSA-N |
| XLogP | 4.58 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.16 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|