C20H18BrIN2O4 — CID 21169957
5-bromo-6-iodo-N-[(E)-(3-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21169957) has the molecular formula C20H18BrIN2O4 and a molecular weight of 557.18 g/mol. Its IUPAC name is 5-bromo-6-iodo-N-[(E)-(3-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-6-iodo-N-[(E)-(3-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21169957 |
| Molecular Formula | C20H18BrIN2O4 |
| Molecular Weight | 557.18 g/mol |
| Exact Mass | 555.95 |
| IUPAC Name | 5-bromo-6-iodo-N-[(E)-(3-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2cc3cc(Br)c(I)cc3o2)ccc1OC(C)C |
| InChI | InChI=1S/C20H18BrIN2O4/c1-11(2)27-16-5-4-12(6-18(16)26-3)10-23-24-20(25)19-8-13-7-14(21)15(22)9-17(13)28-19/h4-11H,1-3H3,(H,24,25)/b23-10+ |
| InChIKey | YWSPSEOKYSTLQB-AUEPDCJTSA-N |
| XLogP | 5.36 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.18 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|