C25H18BrClFN3O5 — CID 126383244
5-bromo-N-[(Z)-[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-7-methoxy-1-benzofuran-2-carboxamide (PubChem CID 126383244) has the molecular formula C25H18BrClFN3O5 and a molecular weight of 574.79 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-7-methoxy-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(Z)-[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-7-methoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126383244 |
| Molecular Formula | C25H18BrClFN3O5 |
| Molecular Weight | 574.79 g/mol |
| Exact Mass | 573.01 |
| IUPAC Name | 5-bromo-N-[(Z)-[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-7-methoxy-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(Br)cc2cc(C(=O)N/N=C\c3ccc(OCC(=O)Nc4ccccc4F)c(Cl)c3)oc12 |
| InChI | InChI=1S/C25H18BrClFN3O5/c1-34-21-11-16(26)9-15-10-22(36-24(15)21)25(33)31-29-12-14-6-7-20(17(27)8-14)35-13-23(32)30-19-5-3-2-4-18(19)28/h2-12H,13H2,1H3,(H,30,32)(H,31,33)/b29-12- |
| InChIKey | RGASRUMZTWKMEC-ULPWCQAASA-N |
| XLogP | 5.78 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.79 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|