C27H21ClFN3O4 — CID 126388835
2-[2-chloro-4-[(E)-[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide (PubChem CID 126388835) has the molecular formula C27H21ClFN3O4 and a molecular weight of 505.93 g/mol. Its IUPAC name is 2-[2-chloro-4-[(E)-[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(E)-[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126388835 |
| Molecular Formula | C27H21ClFN3O4 |
| Molecular Weight | 505.93 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | 2-[2-chloro-4-[(E)-[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(COc1cccc2ccccc12)N/N=C/c1ccc(OCC(=O)Nc2ccccc2F)c(Cl)c1 |
| InChI | InChI=1S/C27H21ClFN3O4/c28-21-14-18(12-13-25(21)36-16-26(33)31-23-10-4-3-9-22(23)29)15-30-32-27(34)17-35-24-11-5-7-19-6-1-2-8-20(19)24/h1-15H,16-17H2,(H,31,33)(H,32,34)/b30-15+ |
| InChIKey | CCZNMZDJENQLMF-FJEPWZHXSA-N |
| XLogP | 5.18 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.93 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|