C23H18Cl2FN3O4 — CID 124551297
N-[(E)-[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(3-chlorophenoxy)acetamide (PubChem CID 124551297) has the molecular formula C23H18Cl2FN3O4 and a molecular weight of 490.32 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(3-chlorophenoxy)acetamide.
| Compound Name | N-[(E)-[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(3-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 124551297 |
| Molecular Formula | C23H18Cl2FN3O4 |
| Molecular Weight | 490.32 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | N-[(E)-[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(3-chlorophenoxy)acetamide |
| SMILES | O=C(COc1cccc(Cl)c1)N/N=C/c1ccc(OCC(=O)Nc2ccccc2F)c(Cl)c1 |
| InChI | InChI=1S/C23H18Cl2FN3O4/c24-16-4-3-5-17(11-16)32-14-23(31)29-27-12-15-8-9-21(18(25)10-15)33-13-22(30)28-20-7-2-1-6-19(20)26/h1-12H,13-14H2,(H,28,30)(H,29,31)/b27-12+ |
| InChIKey | KMSHMTRXWYSBEH-KKMKTNMSSA-N |
| XLogP | 4.68 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.32 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|