C11H15Cl2N3O3 — CID 119821355
3-amino-N-[(2-chloro-5-nitrophenyl)methyl]butanamide;hydrochloride (PubChem CID 119821355) has the molecular formula C11H15Cl2N3O3 and a molecular weight of 308.17 g/mol. Its IUPAC name is 3-amino-N-[(2-chloro-5-nitrophenyl)methyl]butanamide;hydrochloride.
| Compound Name | 3-amino-N-[(2-chloro-5-nitrophenyl)methyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119821355 |
| Molecular Formula | C11H15Cl2N3O3 |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 3-amino-N-[(2-chloro-5-nitrophenyl)methyl]butanamide;hydrochloride |
| SMILES | CC(N)CC(=O)NCc1cc([N+](=O)[O-])ccc1Cl.Cl |
| InChI | InChI=1S/C11H14ClN3O3.ClH/c1-7(13)4-11(16)14-6-8-5-9(15(17)18)2-3-10(8)12;/h2-3,5,7H,4,6,13H2,1H3,(H,14,16);1H |
| InChIKey | CUYJBPOAQNBVLO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|