C14H15NO2S — CID 117407876
1-(2-ethyl-1,3-benzothiazol-6-yl)cyclobutane-1-carboxylic acid (PubChem CID 117407876) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is 1-(2-ethyl-1,3-benzothiazol-6-yl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(2-ethyl-1,3-benzothiazol-6-yl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 117407876 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 1-(2-ethyl-1,3-benzothiazol-6-yl)cyclobutane-1-carboxylic acid |
| SMILES | CCc1nc2ccc(C3(C(=O)O)CCC3)cc2s1 |
| InChI | InChI=1S/C14H15NO2S/c1-2-12-15-10-5-4-9(8-11(10)18-12)14(13(16)17)6-3-7-14/h4-5,8H,2-3,6-7H2,1H3,(H,16,17) |
| InChIKey | JSOROUDIPYJGDS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |