About 2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]cyclopentyl]acetic acid
2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]cyclopentyl]acetic acid (PubChem CID 79142694) has the molecular formula C16H19NO2S
and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]cyclopentyl]acetic acid.
Molecular Properties
| Compound Name | 2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]cyclopentyl]acetic acid |
| PubChem CID | 79142694 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]cyclopentyl]acetic acid |
| SMILES | Cc1ccc2nc(CC3(CC(=O)O)CCCC3)sc2c1 |
| InChI | InChI=1S/C16H19NO2S/c1-11-4-5-12-13(8-11)20-14(17-12)9-16(10-15(18)19)6-2-3-7-16/h4-5,8H,2-3,6-7,9-10H2,1H3,(H,18,19) |
| InChIKey | GXHGFPURWIBWHJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]cyclopentyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]cyclopentyl]acetic acid?
The IUPAC name of 2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]cyclopentyl]acetic acid (CID 79142694) is 2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]cyclopentyl]acetic acid.
What is the SMILES notation for 2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]cyclopentyl]acetic acid?
The canonical SMILES for 2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]cyclopentyl]acetic acid is Cc1ccc2nc(CC3(CC(=O)O)CCCC3)sc2c1.
What is the InChIKey of 2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]cyclopentyl]acetic acid?
The InChIKey is GXHGFPURWIBWHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2S/c1-11-4-5-12-13(8-11)20-14(17-12)9-16(10-15(18)19)6-2-3-7-16/h4-5,8H,2-3,6-7,9-10H2,1H3,(H,18,19).
What are the key properties of 2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]cyclopentyl]acetic acid?
2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]cyclopentyl]acetic acid has a molecular weight of 289.40 g/mol, XLogP of 4.18, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]cyclopentyl]acetic acid is sourced from PubChem (CID 79142694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).