About 1-(1,2,3-benzothiadiazol-5-yl)cyclopentane-1-carboxylic acid
1-(1,2,3-benzothiadiazol-5-yl)cyclopentane-1-carboxylic acid (PubChem CID 117373674) has the molecular formula C12H12N2O2S
and a molecular weight of 248.31 g/mol. Its IUPAC name is 1-(1,2,3-benzothiadiazol-5-yl)cyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-(1,2,3-benzothiadiazol-5-yl)cyclopentane-1-carboxylic acid |
| PubChem CID | 117373674 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 1-(1,2,3-benzothiadiazol-5-yl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ccc3snnc3c2)CCCC1 |
| InChI | InChI=1S/C12H12N2O2S/c15-11(16)12(5-1-2-6-12)8-3-4-10-9(7-8)13-14-17-10/h3-4,7H,1-2,5-6H2,(H,15,16) |
| InChIKey | GSCDMCYHBXDFIE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,2,3-benzothiadiazol-5-yl)cyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2,3-benzothiadiazol-5-yl)cyclopentane-1-carboxylic acid?
The IUPAC name of 1-(1,2,3-benzothiadiazol-5-yl)cyclopentane-1-carboxylic acid (CID 117373674) is 1-(1,2,3-benzothiadiazol-5-yl)cyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-(1,2,3-benzothiadiazol-5-yl)cyclopentane-1-carboxylic acid?
The canonical SMILES for 1-(1,2,3-benzothiadiazol-5-yl)cyclopentane-1-carboxylic acid is O=C(O)C1(c2ccc3snnc3c2)CCCC1.
What is the InChIKey of 1-(1,2,3-benzothiadiazol-5-yl)cyclopentane-1-carboxylic acid?
The InChIKey is GSCDMCYHBXDFIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2S/c15-11(16)12(5-1-2-6-12)8-3-4-10-9(7-8)13-14-17-10/h3-4,7H,1-2,5-6H2,(H,15,16).
What are the key properties of 1-(1,2,3-benzothiadiazol-5-yl)cyclopentane-1-carboxylic acid?
1-(1,2,3-benzothiadiazol-5-yl)cyclopentane-1-carboxylic acid has a molecular weight of 248.31 g/mol, XLogP of 2.59, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2,3-benzothiadiazol-5-yl)cyclopentane-1-carboxylic acid is sourced from PubChem (CID 117373674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).