C13H14N2O3S — CID 136503178
2-[1-(6-hydroxy-1,3-benzothiazol-2-yl)ethylideneamino]butanoic acid (PubChem CID 136503178) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-[1-(6-hydroxy-1,3-benzothiazol-2-yl)ethylideneamino]butanoic acid.
| Compound Name | 2-[1-(6-hydroxy-1,3-benzothiazol-2-yl)ethylideneamino]butanoic acid |
|---|---|
| PubChem CID | 136503178 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-[1-(6-hydroxy-1,3-benzothiazol-2-yl)ethylideneamino]butanoic acid |
| SMILES | CCC(/N=C(\C)c1nc2ccc(O)cc2s1)C(=O)O |
| InChI | InChI=1S/C13H14N2O3S/c1-3-9(13(17)18)14-7(2)12-15-10-5-4-8(16)6-11(10)19-12/h4-6,9,16H,3H2,1-2H3,(H,17,18)/b14-7+ |
| InChIKey | YTPAKBADKDJPIB-VGOFMYFVSA-N |
| XLogP | 2.67 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|