C14H15N3O4S — CID 89222350
2-[1-[6-(carboxyamino)-1,3-benzothiazol-2-yl]ethylideneamino]butanoic acid (PubChem CID 89222350) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is 2-[1-[6-(carboxyamino)-1,3-benzothiazol-2-yl]ethylideneamino]butanoic acid.
| Compound Name | 2-[1-[6-(carboxyamino)-1,3-benzothiazol-2-yl]ethylideneamino]butanoic acid |
|---|---|
| PubChem CID | 89222350 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-[1-[6-(carboxyamino)-1,3-benzothiazol-2-yl]ethylideneamino]butanoic acid |
| SMILES | CCC(/N=C(\C)c1nc2ccc(NC(=O)O)cc2s1)C(=O)O |
| InChI | InChI=1S/C14H15N3O4S/c1-3-9(13(18)19)15-7(2)12-17-10-5-4-8(16-14(20)21)6-11(10)22-12/h4-6,9,16H,3H2,1-2H3,(H,18,19)(H,20,21)/b15-7+ |
| InChIKey | CBIJJAUDARHDBV-VIZOYTHASA-N |
| XLogP | 3.06 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|