C23H27F4N3O3 — CID 71295573
N-[[1-[2-(5,7-dioxo-1-azaspiro[3.4]octan-6-yl)ethyl]piperidin-4-yl]methyl]-3-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 71295573) has the molecular formula C23H27F4N3O3 and a molecular weight of 469.48 g/mol. Its IUPAC name is N-[[1-[2-(5,7-dioxo-1-azaspiro[3.4]octan-6-yl)ethyl]piperidin-4-yl]methyl]-3-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-[[1-[2-(5,7-dioxo-1-azaspiro[3.4]octan-6-yl)ethyl]piperidin-4-yl]methyl]-3-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 71295573 |
| Molecular Formula | C23H27F4N3O3 |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[[1-[2-(5,7-dioxo-1-azaspiro[3.4]octan-6-yl)ethyl]piperidin-4-yl]methyl]-3-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC1CCN(CCC2C(=O)CC3(CCN3)C2=O)CC1)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H27F4N3O3/c24-17-10-15(9-16(11-17)23(25,26)27)21(33)28-13-14-1-6-30(7-2-14)8-3-18-19(31)12-22(20(18)32)4-5-29-22/h9-11,14,18,29H,1-8,12-13H2,(H,28,33) |
| InChIKey | FBODFIIQENEMDO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|