C17H16F3N5O2 — CID 167812615
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-oxo-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-5-carboxamide (PubChem CID 167812615) has the molecular formula C17H16F3N5O2 and a molecular weight of 379.34 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-oxo-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-5-carboxamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-oxo-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 167812615 |
| Molecular Formula | C17H16F3N5O2 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-oxo-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-5-carboxamide |
| SMILES | C#CCCC1(CCNC(=O)c2ccc3[nH]c(=O)n(CC(F)(F)F)c3c2)N=N1 |
| InChI | InChI=1S/C17H16F3N5O2/c1-2-3-6-16(23-24-16)7-8-21-14(26)11-4-5-12-13(9-11)25(15(27)22-12)10-17(18,19)20/h1,4-5,9H,3,6-8,10H2,(H,21,26)(H,22,27) |
| InChIKey | AOSMYZFSLXUVME-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|