C16H15F3N4OS — CID 146152628
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-4-(2,2,2-trifluoroethyl)thieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 146152628) has the molecular formula C16H15F3N4OS and a molecular weight of 368.38 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-4-(2,2,2-trifluoroethyl)thieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-4-(2,2,2-trifluoroethyl)thieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 146152628 |
| Molecular Formula | C16H15F3N4OS |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-4-(2,2,2-trifluoroethyl)thieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | C#CCCC1(CCNC(=O)c2cc3sccc3n2CC(F)(F)F)N=N1 |
| InChI | InChI=1S/C16H15F3N4OS/c1-2-3-5-15(21-22-15)6-7-20-14(24)12-9-13-11(4-8-25-13)23(12)10-16(17,18)19/h1,4,8-9H,3,5-7,10H2,(H,20,24) |
| InChIKey | IDKSPCOOOZANQZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 58.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|