C17H18N6O — CID 166409920
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-4-(1H-1,2,4-triazol-5-ylmethyl)benzamide (PubChem CID 166409920) has the molecular formula C17H18N6O and a molecular weight of 322.37 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-4-(1H-1,2,4-triazol-5-ylmethyl)benzamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-4-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 166409920 |
| Molecular Formula | C17H18N6O |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-4-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
| SMILES | C#CCCC1(CCNC(=O)c2ccc(Cc3ncn[nH]3)cc2)N=N1 |
| InChI | InChI=1S/C17H18N6O/c1-2-3-8-17(22-23-17)9-10-18-16(24)14-6-4-13(5-7-14)11-15-19-12-20-21-15/h1,4-7,12H,3,8-11H2,(H,18,24)(H,19,20,21) |
| InChIKey | QJNINCJRKHYQNM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|