C19H24ClN3O2 — CID 55924641
1-(3-chlorophenyl)-N-[2-(2-methylcyclohexyl)oxyethyl]pyrazole-3-carboxamide (PubChem CID 55924641) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[2-(2-methylcyclohexyl)oxyethyl]pyrazole-3-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[2-(2-methylcyclohexyl)oxyethyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55924641 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[2-(2-methylcyclohexyl)oxyethyl]pyrazole-3-carboxamide |
| SMILES | CC1CCCCC1OCCNC(=O)c1ccn(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C19H24ClN3O2/c1-14-5-2-3-8-18(14)25-12-10-21-19(24)17-9-11-23(22-17)16-7-4-6-15(20)13-16/h4,6-7,9,11,13-14,18H,2-3,5,8,10,12H2,1H3,(H,21,24) |
| InChIKey | TTZCSINMQJMONM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|