C20H26N6O4 — CID 86946002
N-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-5-nitro-1H-indazole-3-carboxamide (PubChem CID 86946002) has the molecular formula C20H26N6O4 and a molecular weight of 414.47 g/mol. Its IUPAC name is N-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-5-nitro-1H-indazole-3-carboxamide.
| Compound Name | N-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-5-nitro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 86946002 |
| Molecular Formula | C20H26N6O4 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | N-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethyl]-5-nitro-1H-indazole-3-carboxamide |
| SMILES | O=C(NCCN1CCN(C(=O)C2CCCC2)CC1)c1n[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C20H26N6O4/c27-19(18-16-13-15(26(29)30)5-6-17(16)22-23-18)21-7-8-24-9-11-25(12-10-24)20(28)14-3-1-2-4-14/h5-6,13-14H,1-4,7-12H2,(H,21,27)(H,22,23) |
| InChIKey | HSXMYAAYIXOVSW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 124.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|