C19H23N7O — CID 39541539
N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1H-indazole-7-carboxamide (PubChem CID 39541539) has the molecular formula C19H23N7O and a molecular weight of 365.44 g/mol. Its IUPAC name is N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1H-indazole-7-carboxamide.
| Compound Name | N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1H-indazole-7-carboxamide |
|---|---|
| PubChem CID | 39541539 |
| Molecular Formula | C19H23N7O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1H-indazole-7-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ncccn2)CC1)c1cccc2cn[nH]c12 |
| InChI | InChI=1S/C19H23N7O/c27-18(16-5-1-4-15-14-23-24-17(15)16)20-8-3-9-25-10-12-26(13-11-25)19-21-6-2-7-22-19/h1-2,4-7,14H,3,8-13H2,(H,20,27)(H,23,24) |
| InChIKey | MZVGHHHCECAZKZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|