C17H21N3O5S — CID 7618911
3,4-dimethoxy-N-[2-(pyridin-2-ylmethylsulfamoyl)ethyl]benzamide (PubChem CID 7618911) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-(pyridin-2-ylmethylsulfamoyl)ethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[2-(pyridin-2-ylmethylsulfamoyl)ethyl]benzamide |
|---|---|
| PubChem CID | 7618911 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 3,4-dimethoxy-N-[2-(pyridin-2-ylmethylsulfamoyl)ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCS(=O)(=O)NCc2ccccn2)cc1OC |
| InChI | InChI=1S/C17H21N3O5S/c1-24-15-7-6-13(11-16(15)25-2)17(21)19-9-10-26(22,23)20-12-14-5-3-4-8-18-14/h3-8,11,20H,9-10,12H2,1-2H3,(H,19,21) |
| InChIKey | OFPWFMYOZWYHMA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |