C14H20O6 — CID 62397627
2-[hydroxy-(2,3,4-trimethoxyphenyl)methyl]butanoic acid (PubChem CID 62397627) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-[hydroxy-(2,3,4-trimethoxyphenyl)methyl]butanoic acid.
| Compound Name | 2-[hydroxy-(2,3,4-trimethoxyphenyl)methyl]butanoic acid |
|---|---|
| PubChem CID | 62397627 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-[hydroxy-(2,3,4-trimethoxyphenyl)methyl]butanoic acid |
| SMILES | CCC(C(=O)O)C(O)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C14H20O6/c1-5-8(14(16)17)11(15)9-6-7-10(18-2)13(20-4)12(9)19-3/h6-8,11,15H,5H2,1-4H3,(H,16,17) |
| InChIKey | WMNULRHHQROEHO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |