C15H25NO4 — CID 65185942
2-(aminomethyl)-3-methyl-1-(2,3,4-trimethoxyphenyl)butan-1-ol (PubChem CID 65185942) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-(aminomethyl)-3-methyl-1-(2,3,4-trimethoxyphenyl)butan-1-ol.
| Compound Name | 2-(aminomethyl)-3-methyl-1-(2,3,4-trimethoxyphenyl)butan-1-ol |
|---|---|
| PubChem CID | 65185942 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-(aminomethyl)-3-methyl-1-(2,3,4-trimethoxyphenyl)butan-1-ol |
| SMILES | COc1ccc(C(O)C(CN)C(C)C)c(OC)c1OC |
| InChI | InChI=1S/C15H25NO4/c1-9(2)11(8-16)13(17)10-6-7-12(18-3)15(20-5)14(10)19-4/h6-7,9,11,13,17H,8,16H2,1-5H3 |
| InChIKey | FXBSXYWARZTGGL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |