C9H12FNO2 — CID 55272766
2-amino-2-(2-fluoro-4-methoxyphenyl)ethanol (PubChem CID 55272766) has the molecular formula C9H12FNO2 and a molecular weight of 185.20 g/mol. Its IUPAC name is 2-amino-2-(2-fluoro-4-methoxyphenyl)ethanol.
| Compound Name | 2-amino-2-(2-fluoro-4-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 55272766 |
| Molecular Formula | C9H12FNO2 |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 2-amino-2-(2-fluoro-4-methoxyphenyl)ethanol |
| SMILES | COc1ccc(C(N)CO)c(F)c1 |
| InChI | InChI=1S/C9H12FNO2/c1-13-6-2-3-7(8(10)4-6)9(11)5-12/h2-4,9,12H,5,11H2,1H3 |
| InChIKey | VLJUIYMCMQFPJT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |