C9H13ClFNO2 — CID 171229266
(2R)-2-amino-2-(2-fluoro-5-methoxyphenyl)ethanol;hydrochloride (PubChem CID 171229266) has the molecular formula C9H13ClFNO2 and a molecular weight of 221.66 g/mol. Its IUPAC name is (2R)-2-amino-2-(2-fluoro-5-methoxyphenyl)ethanol;hydrochloride.
| Compound Name | (2R)-2-amino-2-(2-fluoro-5-methoxyphenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 171229266 |
| Molecular Formula | C9H13ClFNO2 |
| Molecular Weight | 221.66 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | (2R)-2-amino-2-(2-fluoro-5-methoxyphenyl)ethanol;hydrochloride |
| SMILES | COc1ccc(F)c([C@@H](N)CO)c1.Cl |
| InChI | InChI=1S/C9H12FNO2.ClH/c1-13-6-2-3-8(10)7(4-6)9(11)5-12;/h2-4,9,12H,5,11H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | HJUABYQGQIJZSA-FVGYRXGTSA-N |
| XLogP | 1.25 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.66 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |