C10H12F4N2O2 — CID 170828929
3-amino-1-[4-amino-5-fluoro-2-(trifluoromethyl)phenyl]propane-1,2-diol (PubChem CID 170828929) has the molecular formula C10H12F4N2O2 and a molecular weight of 268.21 g/mol. Its IUPAC name is 3-amino-1-[4-amino-5-fluoro-2-(trifluoromethyl)phenyl]propane-1,2-diol.
| Compound Name | 3-amino-1-[4-amino-5-fluoro-2-(trifluoromethyl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 170828929 |
| Molecular Formula | C10H12F4N2O2 |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 3-amino-1-[4-amino-5-fluoro-2-(trifluoromethyl)phenyl]propane-1,2-diol |
| SMILES | NCC(O)C(O)c1cc(F)c(N)cc1C(F)(F)F |
| InChI | InChI=1S/C10H12F4N2O2/c11-6-1-4(9(18)8(17)3-15)5(2-7(6)16)10(12,13)14/h1-2,8-9,17-18H,3,15-16H2 |
| InChIKey | DBNAUTLQXGSIMQ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|