About 1-pyridin-2-yloxy-3-(2,4,6-trimethylphenoxy)propan-2-ol
1-pyridin-2-yloxy-3-(2,4,6-trimethylphenoxy)propan-2-ol (PubChem CID 71254072) has the molecular formula C17H21NO3
and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-pyridin-2-yloxy-3-(2,4,6-trimethylphenoxy)propan-2-ol.
Molecular Properties
| Compound Name | 1-pyridin-2-yloxy-3-(2,4,6-trimethylphenoxy)propan-2-ol |
| PubChem CID | 71254072 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1-pyridin-2-yloxy-3-(2,4,6-trimethylphenoxy)propan-2-ol |
| SMILES | Cc1cc(C)c(OCC(O)COc2ccccn2)c(C)c1 |
| InChI | InChI=1S/C17H21NO3/c1-12-8-13(2)17(14(3)9-12)21-11-15(19)10-20-16-6-4-5-7-18-16/h4-9,15,19H,10-11H2,1-3H3 |
| InChIKey | GTCHAEQKKCUHMU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-pyridin-2-yloxy-3-(2,4,6-trimethylphenoxy)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-2-yloxy-3-(2,4,6-trimethylphenoxy)propan-2-ol?
The IUPAC name of 1-pyridin-2-yloxy-3-(2,4,6-trimethylphenoxy)propan-2-ol (CID 71254072) is 1-pyridin-2-yloxy-3-(2,4,6-trimethylphenoxy)propan-2-ol.
What is the SMILES notation for 1-pyridin-2-yloxy-3-(2,4,6-trimethylphenoxy)propan-2-ol?
The canonical SMILES for 1-pyridin-2-yloxy-3-(2,4,6-trimethylphenoxy)propan-2-ol is Cc1cc(C)c(OCC(O)COc2ccccn2)c(C)c1.
What is the InChIKey of 1-pyridin-2-yloxy-3-(2,4,6-trimethylphenoxy)propan-2-ol?
The InChIKey is GTCHAEQKKCUHMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO3/c1-12-8-13(2)17(14(3)9-12)21-11-15(19)10-20-16-6-4-5-7-18-16/h4-9,15,19H,10-11H2,1-3H3.
What are the key properties of 1-pyridin-2-yloxy-3-(2,4,6-trimethylphenoxy)propan-2-ol?
1-pyridin-2-yloxy-3-(2,4,6-trimethylphenoxy)propan-2-ol has a molecular weight of 287.36 g/mol, XLogP of 2.83, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-2-yloxy-3-(2,4,6-trimethylphenoxy)propan-2-ol is sourced from PubChem (CID 71254072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).