C23H32Cl2N2O2-2 — CID 21237751
1-(4-benzylpiperazin-1-yl)-3-(2,4,6-trimethylphenoxy)propan-2-ol dichloride (PubChem CID 21237751) has the molecular formula C23H32Cl2N2O2-2 and a molecular weight of 439.43 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-3-(2,4,6-trimethylphenoxy)propan-2-ol dichloride.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-3-(2,4,6-trimethylphenoxy)propan-2-ol dichloride |
|---|---|
| PubChem CID | 21237751 |
| Molecular Formula | C23H32Cl2N2O2-2 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-3-(2,4,6-trimethylphenoxy)propan-2-ol dichloride |
| SMILES | Cc1cc(C)c(OCC(O)CN2CCN(Cc3ccccc3)CC2)c(C)c1.[Cl-].[Cl-] |
| InChI | InChI=1S/C23H32N2O2.2ClH/c1-18-13-19(2)23(20(3)14-18)27-17-22(26)16-25-11-9-24(10-12-25)15-21-7-5-4-6-8-21;;/h4-8,13-14,22,26H,9-12,15-17H2,1-3H3;2*1H/p-2 |
| InChIKey | PEMMJRJPZWMSNB-UHFFFAOYSA-L |
| XLogP | -2.82 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |