C25H36N2O2 — CID 34065349
(2R)-1-(4-benzylpiperazin-1-yl)-3-(2-tert-butyl-4-methylphenoxy)propan-2-ol (PubChem CID 34065349) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is (2R)-1-(4-benzylpiperazin-1-yl)-3-(2-tert-butyl-4-methylphenoxy)propan-2-ol.
| Compound Name | (2R)-1-(4-benzylpiperazin-1-yl)-3-(2-tert-butyl-4-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 34065349 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | (2R)-1-(4-benzylpiperazin-1-yl)-3-(2-tert-butyl-4-methylphenoxy)propan-2-ol |
| SMILES | Cc1ccc(OC[C@H](O)CN2CCN(Cc3ccccc3)CC2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H36N2O2/c1-20-10-11-24(23(16-20)25(2,3)4)29-19-22(28)18-27-14-12-26(13-15-27)17-21-8-6-5-7-9-21/h5-11,16,22,28H,12-15,17-19H2,1-4H3/t22-/m1/s1 |
| InChIKey | XNYWUQYZSONDEQ-JOCHJYFZSA-N |
| XLogP | 3.85 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |