C24H33FN2O2 — CID 23940413
1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-3-(5-methyl-2-propan-2-ylphenoxy)propan-2-ol (PubChem CID 23940413) has the molecular formula C24H33FN2O2 and a molecular weight of 400.54 g/mol. Its IUPAC name is 1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-3-(5-methyl-2-propan-2-ylphenoxy)propan-2-ol.
| Compound Name | 1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-3-(5-methyl-2-propan-2-ylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 23940413 |
| Molecular Formula | C24H33FN2O2 |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-3-(5-methyl-2-propan-2-ylphenoxy)propan-2-ol |
| SMILES | Cc1ccc(C(C)C)c(OCC(O)CN2CCN(Cc3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C24H33FN2O2/c1-18(2)23-9-4-19(3)14-24(23)29-17-22(28)16-27-12-10-26(11-13-27)15-20-5-7-21(25)8-6-20/h4-9,14,18,22,28H,10-13,15-17H2,1-3H3 |
| InChIKey | URTLCYDFFKBGGI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |