C9H15ClSi — CID 160884326
1-(chloromethyl)-3,5-dimethylbenzene;silane (PubChem CID 160884326) has the molecular formula C9H15ClSi and a molecular weight of 186.76 g/mol. Its IUPAC name is 1-(chloromethyl)-3,5-dimethylbenzene;silane.
| Compound Name | 1-(chloromethyl)-3,5-dimethylbenzene;silane |
|---|---|
| PubChem CID | 160884326 |
| Molecular Formula | C9H15ClSi |
| Molecular Weight | 186.76 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 1-(chloromethyl)-3,5-dimethylbenzene;silane |
| SMILES | Cc1cc(C)cc(CCl)c1.[SiH4] |
| InChI | InChI=1S/C9H11Cl.H4Si/c1-7-3-8(2)5-9(4-7)6-10;/h3-5H,6H2,1-2H3;1H4 |
| InChIKey | SNKZHUCCZMULLN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.76 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|