C17H16Cl4 — CID 21043179
1-[[3,5-bis(chloromethyl)phenyl]methyl]-3,5-bis(chloromethyl)benzene (PubChem CID 21043179) has the molecular formula C17H16Cl4 and a molecular weight of 362.13 g/mol. Its IUPAC name is 1-[[3,5-bis(chloromethyl)phenyl]methyl]-3,5-bis(chloromethyl)benzene.
| Compound Name | 1-[[3,5-bis(chloromethyl)phenyl]methyl]-3,5-bis(chloromethyl)benzene |
|---|---|
| PubChem CID | 21043179 |
| Molecular Formula | C17H16Cl4 |
| Molecular Weight | 362.13 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 1-[[3,5-bis(chloromethyl)phenyl]methyl]-3,5-bis(chloromethyl)benzene |
| SMILES | ClCc1cc(CCl)cc(Cc2cc(CCl)cc(CCl)c2)c1 |
| InChI | InChI=1S/C17H16Cl4/c18-8-14-2-12(3-15(6-14)9-19)1-13-4-16(10-20)7-17(5-13)11-21/h2-7H,1,8-11H2 |
| InChIKey | UZJLXIBMBKUQCC-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.13 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|