C24H22Cl4O2 — CID 15131184
1-[[4-[[3,5-bis(chloromethyl)phenoxy]methyl]phenyl]methoxy]-3,5-bis(chloromethyl)benzene (PubChem CID 15131184) has the molecular formula C24H22Cl4O2 and a molecular weight of 484.25 g/mol. Its IUPAC name is 1-[[4-[[3,5-bis(chloromethyl)phenoxy]methyl]phenyl]methoxy]-3,5-bis(chloromethyl)benzene.
| Compound Name | 1-[[4-[[3,5-bis(chloromethyl)phenoxy]methyl]phenyl]methoxy]-3,5-bis(chloromethyl)benzene |
|---|---|
| PubChem CID | 15131184 |
| Molecular Formula | C24H22Cl4O2 |
| Molecular Weight | 484.25 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | 1-[[4-[[3,5-bis(chloromethyl)phenoxy]methyl]phenyl]methoxy]-3,5-bis(chloromethyl)benzene |
| SMILES | ClCc1cc(CCl)cc(OCc2ccc(COc3cc(CCl)cc(CCl)c3)cc2)c1 |
| InChI | InChI=1S/C24H22Cl4O2/c25-11-19-5-20(12-26)8-23(7-19)29-15-17-1-2-18(4-3-17)16-30-24-9-21(13-27)6-22(10-24)14-28/h1-10H,11-16H2 |
| InChIKey | IOEQYSKUCYEVTJ-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.25 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|