C22H20Cl2O2 — CID 10340152
1,4-bis[[4-(chloromethyl)phenoxy]methyl]benzene (PubChem CID 10340152) has the molecular formula C22H20Cl2O2 and a molecular weight of 387.31 g/mol. Its IUPAC name is 1,4-bis[[4-(chloromethyl)phenoxy]methyl]benzene.
| Compound Name | 1,4-bis[[4-(chloromethyl)phenoxy]methyl]benzene |
|---|---|
| PubChem CID | 10340152 |
| Molecular Formula | C22H20Cl2O2 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 1,4-bis[[4-(chloromethyl)phenoxy]methyl]benzene |
| SMILES | ClCc1ccc(OCc2ccc(COc3ccc(CCl)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H20Cl2O2/c23-13-17-5-9-21(10-6-17)25-15-19-1-2-20(4-3-19)16-26-22-11-7-18(14-24)8-12-22/h1-12H,13-16H2 |
| InChIKey | FHUAIYPRZSFHAD-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|