C13H20ClN — CID 65026563
1-chloro-N-[(3,5-dimethylphenyl)methyl]-2-methylpropan-2-amine (PubChem CID 65026563) has the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. Its IUPAC name is 1-chloro-N-[(3,5-dimethylphenyl)methyl]-2-methylpropan-2-amine.
| Compound Name | 1-chloro-N-[(3,5-dimethylphenyl)methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 65026563 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-chloro-N-[(3,5-dimethylphenyl)methyl]-2-methylpropan-2-amine |
| SMILES | Cc1cc(C)cc(CNC(C)(C)CCl)c1 |
| InChI | InChI=1S/C13H20ClN/c1-10-5-11(2)7-12(6-10)8-15-13(3,4)9-14/h5-7,15H,8-9H2,1-4H3 |
| InChIKey | ZUQYWQGFFZWXFI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|