C12H18ClN — CID 65026271
3-chloro-N-[(3,5-dimethylphenyl)methyl]propan-1-amine (PubChem CID 65026271) has the molecular formula C12H18ClN and a molecular weight of 211.74 g/mol. Its IUPAC name is 3-chloro-N-[(3,5-dimethylphenyl)methyl]propan-1-amine.
| Compound Name | 3-chloro-N-[(3,5-dimethylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 65026271 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 3-chloro-N-[(3,5-dimethylphenyl)methyl]propan-1-amine |
| SMILES | Cc1cc(C)cc(CNCCCCl)c1 |
| InChI | InChI=1S/C12H18ClN/c1-10-6-11(2)8-12(7-10)9-14-5-3-4-13/h6-8,14H,3-5,9H2,1-2H3 |
| InChIKey | OWUOJUDUNVXWHQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|