C26H40N2S2 — CID 58764382
3-(3,5-dimethylphenyl)-N-[3-[3-[(3,5-dimethylphenyl)methylamino]propyldisulfanyl]propyl]propan-1-amine (PubChem CID 58764382) has the molecular formula C26H40N2S2 and a molecular weight of 444.75 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-N-[3-[3-[(3,5-dimethylphenyl)methylamino]propyldisulfanyl]propyl]propan-1-amine.
| Compound Name | 3-(3,5-dimethylphenyl)-N-[3-[3-[(3,5-dimethylphenyl)methylamino]propyldisulfanyl]propyl]propan-1-amine |
|---|---|
| PubChem CID | 58764382 |
| Molecular Formula | C26H40N2S2 |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-N-[3-[3-[(3,5-dimethylphenyl)methylamino]propyldisulfanyl]propyl]propan-1-amine |
| SMILES | Cc1cc(C)cc(CCCNCCCSSCCCNCc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C26H40N2S2/c1-21-14-22(2)17-25(16-21)8-5-9-27-10-6-12-29-30-13-7-11-28-20-26-18-23(3)15-24(4)19-26/h14-19,27-28H,5-13,20H2,1-4H3 |
| InChIKey | TVQRHLZZZAPJJI-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|