C21H28 — CID 22920116
1-[5-(3,5-dimethylphenyl)pentyl]-3,5-dimethylbenzene (PubChem CID 22920116) has the molecular formula C21H28 and a molecular weight of 280.46 g/mol. Its IUPAC name is 1-[5-(3,5-dimethylphenyl)pentyl]-3,5-dimethylbenzene.
| Compound Name | 1-[5-(3,5-dimethylphenyl)pentyl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 22920116 |
| Molecular Formula | C21H28 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 1-[5-(3,5-dimethylphenyl)pentyl]-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(CCCCCc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C21H28/c1-16-10-17(2)13-20(12-16)8-6-5-7-9-21-14-18(3)11-19(4)15-21/h10-15H,5-9H2,1-4H3 |
| InChIKey | BOTGVGDHJRRVGP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|