C11H16BrP — CID 168765267
bromo-[3-(3,5-dimethylphenyl)propyl]phosphane (PubChem CID 168765267) has the molecular formula C11H16BrP and a molecular weight of 259.13 g/mol. Its IUPAC name is bromo-[3-(3,5-dimethylphenyl)propyl]phosphane.
| Compound Name | bromo-[3-(3,5-dimethylphenyl)propyl]phosphane |
|---|---|
| PubChem CID | 168765267 |
| Molecular Formula | C11H16BrP |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | bromo-[3-(3,5-dimethylphenyl)propyl]phosphane |
| SMILES | Cc1cc(C)cc(CCCPBr)c1 |
| InChI | InChI=1S/C11H16BrP/c1-9-6-10(2)8-11(7-9)4-3-5-13-12/h6-8,13H,3-5H2,1-2H3 |
| InChIKey | XRMDCUKNDJHNJE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|