C11H16ClOP — CID 168765246
chloro-[3-(3,5-dimethylphenyl)propoxy]phosphane (PubChem CID 168765246) has the molecular formula C11H16ClOP and a molecular weight of 230.67 g/mol. Its IUPAC name is chloro-[3-(3,5-dimethylphenyl)propoxy]phosphane.
| Compound Name | chloro-[3-(3,5-dimethylphenyl)propoxy]phosphane |
|---|---|
| PubChem CID | 168765246 |
| Molecular Formula | C11H16ClOP |
| Molecular Weight | 230.67 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | chloro-[3-(3,5-dimethylphenyl)propoxy]phosphane |
| SMILES | Cc1cc(C)cc(CCCOPCl)c1 |
| InChI | InChI=1S/C11H16ClOP/c1-9-6-10(2)8-11(7-9)4-3-5-13-14-12/h6-8,14H,3-5H2,1-2H3 |
| InChIKey | WCISPASIMLFMHH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.67 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|