C32H41I — CID 122546399
1,3-bis(3-hexyl-5-methylphenyl)-5-iodobenzene (PubChem CID 122546399) has the molecular formula C32H41I and a molecular weight of 552.58 g/mol. Its IUPAC name is 1,3-bis(3-hexyl-5-methylphenyl)-5-iodobenzene.
| Compound Name | 1,3-bis(3-hexyl-5-methylphenyl)-5-iodobenzene |
|---|---|
| PubChem CID | 122546399 |
| Molecular Formula | C32H41I |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 1,3-bis(3-hexyl-5-methylphenyl)-5-iodobenzene |
| SMILES | CCCCCCc1cc(C)cc(-c2cc(I)cc(-c3cc(C)cc(CCCCCC)c3)c2)c1 |
| InChI | InChI=1S/C32H41I/c1-5-7-9-11-13-26-15-24(3)17-28(19-26)30-21-31(23-32(33)22-30)29-18-25(4)16-27(20-29)14-12-10-8-6-2/h15-23H,5-14H2,1-4H3 |
| InChIKey | QUSZQIUCGPIQIJ-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|