C17H20ClN — CID 60687979
2-(4-chlorophenyl)-N-[(3,5-dimethylphenyl)methyl]ethanamine (PubChem CID 60687979) has the molecular formula C17H20ClN and a molecular weight of 273.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(3,5-dimethylphenyl)methyl]ethanamine.
| Compound Name | 2-(4-chlorophenyl)-N-[(3,5-dimethylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 60687979 |
| Molecular Formula | C17H20ClN |
| Molecular Weight | 273.81 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(3,5-dimethylphenyl)methyl]ethanamine |
| SMILES | Cc1cc(C)cc(CNCCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H20ClN/c1-13-9-14(2)11-16(10-13)12-19-8-7-15-3-5-17(18)6-4-15/h3-6,9-11,19H,7-8,12H2,1-2H3 |
| InChIKey | COMKTCDJZRPNBT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.81 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|