C12H17Cl — CID 64666954
1-(3-chloro-2-methylpropyl)-3,5-dimethylbenzene (PubChem CID 64666954) has the molecular formula C12H17Cl and a molecular weight of 196.72 g/mol. Its IUPAC name is 1-(3-chloro-2-methylpropyl)-3,5-dimethylbenzene.
| Compound Name | 1-(3-chloro-2-methylpropyl)-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 64666954 |
| Molecular Formula | C12H17Cl |
| Molecular Weight | 196.72 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-(3-chloro-2-methylpropyl)-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(CC(C)CCl)c1 |
| InChI | InChI=1S/C12H17Cl/c1-9-4-10(2)6-12(5-9)7-11(3)8-13/h4-6,11H,7-8H2,1-3H3 |
| InChIKey | CWEKVGUZOCCUQU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.72 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|