About 1-(2-chlorobutyl)-3,5-dimethylbenzene
1-(2-chlorobutyl)-3,5-dimethylbenzene (PubChem CID 130480288) has the molecular formula C12H17Cl
and a molecular weight of 196.72 g/mol. Its IUPAC name is 1-(2-chlorobutyl)-3,5-dimethylbenzene.
Molecular Properties
| Compound Name | 1-(2-chlorobutyl)-3,5-dimethylbenzene |
| PubChem CID | 130480288 |
| Molecular Formula | C12H17Cl |
| Molecular Weight | 196.72 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-(2-chlorobutyl)-3,5-dimethylbenzene |
| SMILES | CCC(Cl)Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C12H17Cl/c1-4-12(13)8-11-6-9(2)5-10(3)7-11/h5-7,12H,4,8H2,1-3H3 |
| InChIKey | KGAHZQBYNQIBLV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.72 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chlorobutyl)-3,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chlorobutyl)-3,5-dimethylbenzene?
The IUPAC name of 1-(2-chlorobutyl)-3,5-dimethylbenzene (CID 130480288) is 1-(2-chlorobutyl)-3,5-dimethylbenzene.
What is the SMILES notation for 1-(2-chlorobutyl)-3,5-dimethylbenzene?
The canonical SMILES for 1-(2-chlorobutyl)-3,5-dimethylbenzene is CCC(Cl)Cc1cc(C)cc(C)c1.
What is the InChIKey of 1-(2-chlorobutyl)-3,5-dimethylbenzene?
The InChIKey is KGAHZQBYNQIBLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17Cl/c1-4-12(13)8-11-6-9(2)5-10(3)7-11/h5-7,12H,4,8H2,1-3H3.
What are the key properties of 1-(2-chlorobutyl)-3,5-dimethylbenzene?
1-(2-chlorobutyl)-3,5-dimethylbenzene has a molecular weight of 196.72 g/mol, XLogP of 3.86, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorobutyl)-3,5-dimethylbenzene is sourced from PubChem (CID 130480288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).