C14H22ClN — CID 79259499
1-chloro-N-[(3,5-dimethylphenyl)methyl]-3-methylbutan-2-amine (PubChem CID 79259499) has the molecular formula C14H22ClN and a molecular weight of 239.79 g/mol. Its IUPAC name is 1-chloro-N-[(3,5-dimethylphenyl)methyl]-3-methylbutan-2-amine.
| Compound Name | 1-chloro-N-[(3,5-dimethylphenyl)methyl]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 79259499 |
| Molecular Formula | C14H22ClN |
| Molecular Weight | 239.79 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 1-chloro-N-[(3,5-dimethylphenyl)methyl]-3-methylbutan-2-amine |
| SMILES | Cc1cc(C)cc(CNC(CCl)C(C)C)c1 |
| InChI | InChI=1S/C14H22ClN/c1-10(2)14(8-15)16-9-13-6-11(3)5-12(4)7-13/h5-7,10,14,16H,8-9H2,1-4H3 |
| InChIKey | LDKFQSNVPJAFLE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.79 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|