C12H14ClN — CID 63215043
2-(chloromethyl)-3-(3,5-dimethylphenyl)propanenitrile (PubChem CID 63215043) has the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. Its IUPAC name is 2-(chloromethyl)-3-(3,5-dimethylphenyl)propanenitrile.
| Compound Name | 2-(chloromethyl)-3-(3,5-dimethylphenyl)propanenitrile |
|---|---|
| PubChem CID | 63215043 |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 2-(chloromethyl)-3-(3,5-dimethylphenyl)propanenitrile |
| SMILES | Cc1cc(C)cc(CC(C#N)CCl)c1 |
| InChI | InChI=1S/C12H14ClN/c1-9-3-10(2)5-11(4-9)6-12(7-13)8-14/h3-5,12H,6-7H2,1-2H3 |
| InChIKey | YFUCQXJWUUGOHF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|