About 3-(3,5-dimethylphenyl)-2,2-dimethylpropanenitrile
3-(3,5-dimethylphenyl)-2,2-dimethylpropanenitrile (PubChem CID 65379308) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-2,2-dimethylpropanenitrile.
Molecular Properties
| Compound Name | 3-(3,5-dimethylphenyl)-2,2-dimethylpropanenitrile |
| PubChem CID | 65379308 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-2,2-dimethylpropanenitrile |
| SMILES | Cc1cc(C)cc(CC(C)(C)C#N)c1 |
| InChI | InChI=1S/C13H17N/c1-10-5-11(2)7-12(6-10)8-13(3,4)9-14/h5-7H,8H2,1-4H3 |
| InChIKey | WGSFMHBXWVRXFR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3,5-dimethylphenyl)-2,2-dimethylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethylphenyl)-2,2-dimethylpropanenitrile?
The IUPAC name of 3-(3,5-dimethylphenyl)-2,2-dimethylpropanenitrile (CID 65379308) is 3-(3,5-dimethylphenyl)-2,2-dimethylpropanenitrile.
What is the SMILES notation for 3-(3,5-dimethylphenyl)-2,2-dimethylpropanenitrile?
The canonical SMILES for 3-(3,5-dimethylphenyl)-2,2-dimethylpropanenitrile is Cc1cc(C)cc(CC(C)(C)C#N)c1.
What is the InChIKey of 3-(3,5-dimethylphenyl)-2,2-dimethylpropanenitrile?
The InChIKey is WGSFMHBXWVRXFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N/c1-10-5-11(2)7-12(6-10)8-13(3,4)9-14/h5-7H,8H2,1-4H3.
What are the key properties of 3-(3,5-dimethylphenyl)-2,2-dimethylpropanenitrile?
3-(3,5-dimethylphenyl)-2,2-dimethylpropanenitrile has a molecular weight of 187.29 g/mol, XLogP of 3.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethylphenyl)-2,2-dimethylpropanenitrile is sourced from PubChem (CID 65379308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).