C18H21Y+2 — CID 20599386
2-[(3,4-dimethylbenzene-5-id-1-yl)methyl]-1,3,5-trimethylbenzene;yttrium(3+) (PubChem CID 20599386) has the molecular formula C18H21Y+2 and a molecular weight of 326.27 g/mol. Its IUPAC name is 2-[(3,4-dimethylbenzene-5-id-1-yl)methyl]-1,3,5-trimethylbenzene;yttrium(3+).
| Compound Name | 2-[(3,4-dimethylbenzene-5-id-1-yl)methyl]-1,3,5-trimethylbenzene;yttrium(3+) |
|---|---|
| PubChem CID | 20599386 |
| Molecular Formula | C18H21Y+2 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2-[(3,4-dimethylbenzene-5-id-1-yl)methyl]-1,3,5-trimethylbenzene;yttrium(3+) |
| SMILES | Cc1cc(C)c(Cc2c[c-]c(C)c(C)c2)c(C)c1.[Y+3] |
| InChI | InChI=1S/C18H21.Y/c1-12-8-15(4)18(16(5)9-12)11-17-7-6-13(2)14(3)10-17;/h7-10H,11H2,1-5H3;/q-1;+3 |
| InChIKey | ACURTVLTEBQFSS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|